C19H19ClN5O2+ — CID 163463931
7-(3-chlorophenyl)-N-(2-methyl-1H-pyrazol-2-ium-4-yl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-5-carboxamide (PubChem CID 163463931) has the molecular formula C19H19ClN5O2+ and a molecular weight of 384.85 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-N-(2-methyl-1H-pyrazol-2-ium-4-yl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-5-carboxamide.
| Compound Name | 7-(3-chlorophenyl)-N-(2-methyl-1H-pyrazol-2-ium-4-yl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-5-carboxamide |
|---|---|
| PubChem CID | 163463931 |
| Molecular Formula | C19H19ClN5O2+ |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 7-(3-chlorophenyl)-N-(2-methyl-1H-pyrazol-2-ium-4-yl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazepine-5-carboxamide |
| SMILES | C[n+]1cc(NC(=O)N2CCCOc3ccc(-c4cccc(Cl)c4)nc32)c[nH]1 |
| InChI | InChI=1S/C19H18ClN5O2/c1-24-12-15(11-21-24)22-19(26)25-8-3-9-27-17-7-6-16(23-18(17)25)13-4-2-5-14(20)10-13/h2,4-7,10-12H,3,8-9H2,1H3,(H,22,26)/p+1 |
| InChIKey | BQXQMGFDVZREQV-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|