About (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione
(4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione (PubChem CID 163464649) has the molecular formula C14H25FO3
and a molecular weight of 260.35 g/mol. Its IUPAC name is (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione.
Molecular Properties
| Compound Name | (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione |
| PubChem CID | 163464649 |
| Molecular Formula | C14H25FO3 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione |
| SMILES | CC(C)(C)OCC(=O)C[C@H](F)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H25FO3/c1-13(2,3)12(17)8-10(15)7-11(16)9-18-14(4,5)6/h10H,7-9H2,1-6H3/t10-/m0/s1 |
| InChIKey | BLXJSGPGARYMDD-JTQLQIEISA-N |
| XLogP | 3.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione?
The IUPAC name of (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione (CID 163464649) is (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione.
What is the SMILES notation for (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione?
The canonical SMILES for (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione is CC(C)(C)OCC(=O)C[C@H](F)CC(=O)C(C)(C)C.
What is the InChIKey of (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione?
The InChIKey is BLXJSGPGARYMDD-JTQLQIEISA-N. The full InChI is InChI=1S/C14H25FO3/c1-13(2,3)12(17)8-10(15)7-11(16)9-18-14(4,5)6/h10H,7-9H2,1-6H3/t10-/m0/s1.
What are the key properties of (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione?
(4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione has a molecular weight of 260.35 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-fluoro-7,7-dimethyl-1-[(2-methylpropan-2-yl)oxy]octane-2,6-dione is sourced from PubChem (CID 163464649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).