C41H35F3N4O6S — CID 163465229
(2S)-2-[[2,6-difluoro-4-[[4-(2-fluoro-4-pyridinyl)phenyl]sulfanylamino]benzoyl]amino]-3-[5-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-8-yl]propanoic acid (PubChem CID 163465229) has the molecular formula C41H35F3N4O6S and a molecular weight of 768.81 g/mol. Its IUPAC name is (2S)-2-[[2,6-difluoro-4-[[4-(2-fluoro-4-pyridinyl)phenyl]sulfanylamino]benzoyl]amino]-3-[5-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-8-yl]propanoic acid.
| Compound Name | (2S)-2-[[2,6-difluoro-4-[[4-(2-fluoro-4-pyridinyl)phenyl]sulfanylamino]benzoyl]amino]-3-[5-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-8-yl]propanoic acid |
|---|---|
| PubChem CID | 163465229 |
| Molecular Formula | C41H35F3N4O6S |
| Molecular Weight | 768.81 g/mol |
| Exact Mass | 768.22 |
| IUPAC Name | (2S)-2-[[2,6-difluoro-4-[[4-(2-fluoro-4-pyridinyl)phenyl]sulfanylamino]benzoyl]amino]-3-[5-[4-(ethoxymethyl)-2,6-dimethoxyphenyl]quinolin-8-yl]propanoic acid |
| SMILES | CCOCc1cc(OC)c(-c2ccc(C[C@H](NC(=O)c3c(F)cc(NSc4ccc(-c5ccnc(F)c5)cc4)cc3F)C(=O)O)c3ncccc23)c(OC)c1 |
| InChI | InChI=1S/C41H35F3N4O6S/c1-4-54-22-23-16-34(52-2)37(35(17-23)53-3)29-12-9-26(39-30(29)6-5-14-46-39)18-33(41(50)51)47-40(49)38-31(42)20-27(21-32(38)43)48-55-28-10-7-24(8-11-28)25-13-15-45-36(44)19-25/h5-17,19-21,33,48H,4,18,22H2,1-3H3,(H,47,49)(H,50,51)/t33-/m0/s1 |
| InChIKey | BSADQMCJQHRGPZ-XIFFEERXSA-N |
| XLogP | 8.48 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.81 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|