About (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium
(6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium (PubChem CID 163466342) has the molecular formula C11H18N+
and a molecular weight of 164.27 g/mol. Its IUPAC name is (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium.
Molecular Properties
| Compound Name | (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium |
| PubChem CID | 163466342 |
| Molecular Formula | C11H18N+ |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium |
| SMILES | C=CC1CC(C)=C(C)CC1C=[NH2+] |
| InChI | InChI=1S/C11H17N/c1-4-10-5-8(2)9(3)6-11(10)7-12/h4,7,10-12H,1,5-6H2,2-3H3/p+1 |
| InChIKey | BSXQGKFBSRCDKB-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 25.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium?
The IUPAC name of (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium (CID 163466342) is (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium.
What is the SMILES notation for (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium?
The canonical SMILES for (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium is C=CC1CC(C)=C(C)CC1C=[NH2+].
What is the InChIKey of (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium?
The InChIKey is BSXQGKFBSRCDKB-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H17N/c1-4-10-5-8(2)9(3)6-11(10)7-12/h4,7,10-12H,1,5-6H2,2-3H3/p+1.
What are the key properties of (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium?
(6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium has a molecular weight of 164.27 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethenyl-3,4-dimethylcyclohex-3-en-1-yl)methylideneazanium is sourced from PubChem (CID 163466342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).