C20H32 — CID 163467052
(1R,3R,4R,6S,7R,8S,12S)-4-[(2R)-butan-2-yl]-3,4,7,12-tetramethyltetracyclo[6.4.0.01,3.06,8]dodec-9-ene (PubChem CID 163467052) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1R,3R,4R,6S,7R,8S,12S)-4-[(2R)-butan-2-yl]-3,4,7,12-tetramethyltetracyclo[6.4.0.01,3.06,8]dodec-9-ene.
| Compound Name | (1R,3R,4R,6S,7R,8S,12S)-4-[(2R)-butan-2-yl]-3,4,7,12-tetramethyltetracyclo[6.4.0.01,3.06,8]dodec-9-ene |
|---|---|
| PubChem CID | 163467052 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1R,3R,4R,6S,7R,8S,12S)-4-[(2R)-butan-2-yl]-3,4,7,12-tetramethyltetracyclo[6.4.0.01,3.06,8]dodec-9-ene |
| SMILES | CC[C@@H](C)[C@@]1(C)C[C@H]2[C@@H](C)[C@@]23C=CC[C@H](C)[C@]32C[C@@]21C |
| InChI | InChI=1S/C20H32/c1-7-13(2)17(5)11-16-15(4)19(16)10-8-9-14(3)20(19)12-18(17,20)6/h8,10,13-16H,7,9,11-12H2,1-6H3/t13-,14+,15-,16+,17-,18-,19+,20+/m1/s1 |
| InChIKey | BTMPMCBJUDZXAS-FWMLDDLOSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|