C29H35FN2O3 — CID 163467068
4-(1'-cyclobutylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)-N-(2-ethenoxyethyl)-2-fluoro-N-methylbenzamide (PubChem CID 163467068) has the molecular formula C29H35FN2O3 and a molecular weight of 478.61 g/mol. Its IUPAC name is 4-(1'-cyclobutylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)-N-(2-ethenoxyethyl)-2-fluoro-N-methylbenzamide.
| Compound Name | 4-(1'-cyclobutylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)-N-(2-ethenoxyethyl)-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 163467068 |
| Molecular Formula | C29H35FN2O3 |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 4-(1'-cyclobutylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)-N-(2-ethenoxyethyl)-2-fluoro-N-methylbenzamide |
| SMILES | C=COCCN(C)C(=O)c1ccc(-c2ccc3c(c2)CCC2(CCN(C4CCC4)CC2)O3)cc1F |
| InChI | InChI=1S/C29H35FN2O3/c1-3-34-18-17-31(2)28(33)25-9-7-22(20-26(25)30)21-8-10-27-23(19-21)11-12-29(35-27)13-15-32(16-14-29)24-5-4-6-24/h3,7-10,19-20,24H,1,4-6,11-18H2,2H3 |
| InChIKey | BTMUTQBSIWYILN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|