About 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine
6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine (PubChem CID 163467291) has the molecular formula C8H11FN4O
and a molecular weight of 198.20 g/mol. Its IUPAC name is 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine.
Molecular Properties
| Compound Name | 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine |
| PubChem CID | 163467291 |
| Molecular Formula | C8H11FN4O |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine |
| SMILES | Nc1ccc(O[C@H]2CNC[C@@H]2F)nn1 |
| InChI | InChI=1S/C8H11FN4O/c9-5-3-11-4-6(5)14-8-2-1-7(10)12-13-8/h1-2,5-6,11H,3-4H2,(H2,10,12)/t5-,6-/m0/s1 |
| InChIKey | BTRDBTXGNAGZKQ-WDSKDSINSA-N |
| XLogP | -0.25 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine?
The IUPAC name of 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine (CID 163467291) is 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine.
What is the SMILES notation for 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine?
The canonical SMILES for 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine is Nc1ccc(O[C@H]2CNC[C@@H]2F)nn1.
What is the InChIKey of 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine?
The InChIKey is BTRDBTXGNAGZKQ-WDSKDSINSA-N. The full InChI is InChI=1S/C8H11FN4O/c9-5-3-11-4-6(5)14-8-2-1-7(10)12-13-8/h1-2,5-6,11H,3-4H2,(H2,10,12)/t5-,6-/m0/s1.
What are the key properties of 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine?
6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine has a molecular weight of 198.20 g/mol, XLogP of -0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3S,4S)-4-fluoropyrrolidin-3-yl]oxypyridazin-3-amine is sourced from PubChem (CID 163467291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).