About (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium
(2S)-1-ethenyl-1,2-dimethylaziridin-1-ium (PubChem CID 163467868) has the molecular formula C6H12N+
and a molecular weight of 98.17 g/mol. Its IUPAC name is (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium.
Molecular Properties
| Compound Name | (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium |
| PubChem CID | 163467868 |
| Molecular Formula | C6H12N+ |
| Molecular Weight | 98.17 g/mol |
| Exact Mass | 98.10 |
| IUPAC Name | (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium |
| SMILES | C=C[N+]1(C)C[C@@H]1C |
| InChI | InChI=1S/C6H12N/c1-4-7(3)5-6(7)2/h4,6H,1,5H2,2-3H3/q+1/t6-,7?/m0/s1 |
| InChIKey | MPOXLSIOAXDOPQ-PKPIPKONSA-N |
| XLogP | 0.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium?
The IUPAC name of (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium (CID 163467868) is (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium.
What is the SMILES notation for (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium?
The canonical SMILES for (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium is C=C[N+]1(C)C[C@@H]1C.
What is the InChIKey of (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium?
The InChIKey is MPOXLSIOAXDOPQ-PKPIPKONSA-N. The full InChI is InChI=1S/C6H12N/c1-4-7(3)5-6(7)2/h4,6H,1,5H2,2-3H3/q+1/t6-,7?/m0/s1.
What are the key properties of (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium?
(2S)-1-ethenyl-1,2-dimethylaziridin-1-ium has a molecular weight of 98.17 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-ethenyl-1,2-dimethylaziridin-1-ium is sourced from PubChem (CID 163467868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).