C46H27NO9 — CID 163468306
9-(7H-benzo[g]carbazol-9-yl)-10-naphtho[2,1-b][1]benzofuran-9-ylanthracene-1,2,3,4,5,6,7,8-octol (PubChem CID 163468306) has the molecular formula C46H27NO9 and a molecular weight of 737.72 g/mol. Its IUPAC name is 9-(7H-benzo[g]carbazol-9-yl)-10-naphtho[2,1-b][1]benzofuran-9-ylanthracene-1,2,3,4,5,6,7,8-octol.
| Compound Name | 9-(7H-benzo[g]carbazol-9-yl)-10-naphtho[2,1-b][1]benzofuran-9-ylanthracene-1,2,3,4,5,6,7,8-octol |
|---|---|
| PubChem CID | 163468306 |
| Molecular Formula | C46H27NO9 |
| Molecular Weight | 737.72 g/mol |
| Exact Mass | 737.17 |
| IUPAC Name | 9-(7H-benzo[g]carbazol-9-yl)-10-naphtho[2,1-b][1]benzofuran-9-ylanthracene-1,2,3,4,5,6,7,8-octol |
| SMILES | Oc1c(O)c(O)c2c(-c3ccc4c(c3)oc3ccc5ccccc5c34)c3c(O)c(O)c(O)c(O)c3c(-c3ccc4c(c3)[nH]c3ccc5ccccc5c34)c2c1O |
| InChI | InChI=1S/C46H27NO9/c48-39-35-31(21-9-13-25-28(17-21)47-27-15-11-19-5-1-3-7-23(19)33(25)27)36-38(42(51)46(55)44(53)40(36)49)32(37(35)41(50)45(54)43(39)52)22-10-14-26-30(18-22)56-29-16-12-20-6-2-4-8-24(20)34(26)29/h1-18,47-55H |
| InChIKey | BULYOBCSTGGTHI-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 190.77 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.72 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|