C11H21NO2 — CID 163469377
(3S)-6-(methylamino)-4-methylidene-3-propylhexanoic acid (PubChem CID 163469377) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (3S)-6-(methylamino)-4-methylidene-3-propylhexanoic acid.
| Compound Name | (3S)-6-(methylamino)-4-methylidene-3-propylhexanoic acid |
|---|---|
| PubChem CID | 163469377 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (3S)-6-(methylamino)-4-methylidene-3-propylhexanoic acid |
| SMILES | C=C(CCNC)[C@@H](CCC)CC(=O)O |
| InChI | InChI=1S/C11H21NO2/c1-4-5-10(8-11(13)14)9(2)6-7-12-3/h10,12H,2,4-8H2,1,3H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | BVHOTPPCHUZMHP-JTQLQIEISA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|