C13H23N3O — CID 163469693
[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 163469693) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is [(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 163469693 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | [(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)N2C[C@H]3CCC[C@H]3C2)CC1 |
| InChI | InChI=1S/C13H23N3O/c1-14-5-7-15(8-6-14)13(17)16-9-11-3-2-4-12(11)10-16/h11-12H,2-10H2,1H3/t11-,12+ |
| InChIKey | BVNPZVJOSIXMLV-TXEJJXNPSA-N |
| XLogP | 1.09 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |