C26H25FN4O3S2 — CID 163469708
[(4aS,6S)-1-(4-fluorophenyl)-6-(1-methylpyrrol-3-yl)sulfonyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f]benzimidazol-4a-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 163469708) has the molecular formula C26H25FN4O3S2 and a molecular weight of 524.64 g/mol. Its IUPAC name is [(4aS,6S)-1-(4-fluorophenyl)-6-(1-methylpyrrol-3-yl)sulfonyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f]benzimidazol-4a-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [(4aS,6S)-1-(4-fluorophenyl)-6-(1-methylpyrrol-3-yl)sulfonyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f]benzimidazol-4a-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 163469708 |
| Molecular Formula | C26H25FN4O3S2 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | [(4aS,6S)-1-(4-fluorophenyl)-6-(1-methylpyrrol-3-yl)sulfonyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f]benzimidazol-4a-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | Cn1ccc(S(=O)(=O)[C@H]2CCC3Cc4c(ncn4-c4ccc(F)cc4)C[C@]3(C(=O)c3nccs3)C2)c1 |
| InChI | InChI=1S/C26H25FN4O3S2/c1-30-10-8-21(15-30)36(33,34)20-7-2-17-12-23-22(29-16-31(23)19-5-3-18(27)4-6-19)14-26(17,13-20)24(32)25-28-9-11-35-25/h3-6,8-11,15-17,20H,2,7,12-14H2,1H3/t17?,20-,26+/m0/s1 |
| InChIKey | UPGOYLJIOZNGRO-HWBHHSTISA-N |
| XLogP | 4.42 |
| TPSA | 86.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |