C14H30N2O3 — CID 163470269
(Z)-2-(dimethylamino)-2-methoxy-6-methyl-9-(methylamino)non-4-ene-1,8-diol (PubChem CID 163470269) has the molecular formula C14H30N2O3 and a molecular weight of 274.41 g/mol. Its IUPAC name is (Z)-2-(dimethylamino)-2-methoxy-6-methyl-9-(methylamino)non-4-ene-1,8-diol.
| Compound Name | (Z)-2-(dimethylamino)-2-methoxy-6-methyl-9-(methylamino)non-4-ene-1,8-diol |
|---|---|
| PubChem CID | 163470269 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (Z)-2-(dimethylamino)-2-methoxy-6-methyl-9-(methylamino)non-4-ene-1,8-diol |
| SMILES | CNCC(O)CC(C)/C=C\CC(CO)(OC)N(C)C |
| InChI | InChI=1S/C14H30N2O3/c1-12(9-13(18)10-15-2)7-6-8-14(11-17,19-5)16(3)4/h6-7,12-13,15,17-18H,8-11H2,1-5H3/b7-6- |
| InChIKey | BVZCOKHIGMXJAQ-SREVYHEPSA-N |
| XLogP | 0.44 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|