About 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide
2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide (PubChem CID 163470378) has the molecular formula C22H31NO4
and a molecular weight of 373.49 g/mol. Its IUPAC name is 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide |
| PubChem CID | 163470378 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide |
| SMILES | O=C(Cc1ccc(COC2=CCC=CCCC2)cc1)NCCOCCCO |
| InChI | InChI=1S/C22H31NO4/c24-14-6-15-26-16-13-23-22(25)17-19-9-11-20(12-10-19)18-27-21-7-4-2-1-3-5-8-21/h1-2,7,9-12,24H,3-6,8,13-18H2,(H,23,25) |
| InChIKey | BWBODBUJNDEBFL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide?
The IUPAC name of 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide (CID 163470378) is 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide.
What is the SMILES notation for 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide?
The canonical SMILES for 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide is O=C(Cc1ccc(COC2=CCC=CCCC2)cc1)NCCOCCCO.
What is the InChIKey of 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide?
The InChIKey is BWBODBUJNDEBFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO4/c24-14-6-15-26-16-13-23-22(25)17-19-9-11-20(12-10-19)18-27-21-7-4-2-1-3-5-8-21/h1-2,7,9-12,24H,3-6,8,13-18H2,(H,23,25).
What are the key properties of 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide?
2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide has a molecular weight of 373.49 g/mol, XLogP of 3.28, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(cycloocta-1,4-dien-1-yloxymethyl)phenyl]-N-[2-(3-hydroxypropoxy)ethyl]acetamide is sourced from PubChem (CID 163470378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).