About ethanimine;N-methylbutan-1-amine;uranium(2+)
ethanimine;N-methylbutan-1-amine;uranium(2+) (PubChem CID 163470467) has the molecular formula C7H16N2U
and a molecular weight of 366.25 g/mol. Its IUPAC name is ethanimine;N-methylbutan-1-amine;uranium(2+).
Molecular Properties
| Compound Name | ethanimine;N-methylbutan-1-amine;uranium(2+) |
| PubChem CID | 163470467 |
| Molecular Formula | C7H16N2U |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethanimine;N-methylbutan-1-amine;uranium(2+) |
| SMILES | [CH2-]CCCNC.[H]/N=[C-]\C.[U+2] |
| InChI | InChI=1S/C5H12N.C2H4N.U/c1-3-4-5-6-2;1-2-3;/h6H,1,3-5H2,2H3;3H,1H3;/q2*-1;+2 |
| InChIKey | SKQXIPZRGYTVJG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethanimine;N-methylbutan-1-amine;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimine;N-methylbutan-1-amine;uranium(2+)?
The IUPAC name of ethanimine;N-methylbutan-1-amine;uranium(2+) (CID 163470467) is ethanimine;N-methylbutan-1-amine;uranium(2+).
What is the SMILES notation for ethanimine;N-methylbutan-1-amine;uranium(2+)?
The canonical SMILES for ethanimine;N-methylbutan-1-amine;uranium(2+) is [CH2-]CCCNC.[H]/N=[C-]\C.[U+2].
What is the InChIKey of ethanimine;N-methylbutan-1-amine;uranium(2+)?
The InChIKey is SKQXIPZRGYTVJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N.C2H4N.U/c1-3-4-5-6-2;1-2-3;/h6H,1,3-5H2,2H3;3H,1H3;/q2*-1;+2.
What are the key properties of ethanimine;N-methylbutan-1-amine;uranium(2+)?
ethanimine;N-methylbutan-1-amine;uranium(2+) has a molecular weight of 366.25 g/mol, XLogP of 1.35, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimine;N-methylbutan-1-amine;uranium(2+) is sourced from PubChem (CID 163470467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).