C24H27F3N2O2 — CID 163470655
(3aR,7aS)-2-[2-(4-methylphenyl)ethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 163470655) has the molecular formula C24H27F3N2O2 and a molecular weight of 432.49 g/mol. Its IUPAC name is (3aR,7aS)-2-[2-(4-methylphenyl)ethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-2-[2-(4-methylphenyl)ethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 163470655 |
| Molecular Formula | C24H27F3N2O2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (3aR,7aS)-2-[2-(4-methylphenyl)ethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | Cc1ccc(CCN2C[C@H]3CCN(c4ccc(OCC(F)(F)F)cc4)C(=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C24H27F3N2O2/c1-17-2-4-18(5-3-17)10-12-28-14-19-11-13-29(23(30)22(19)15-28)20-6-8-21(9-7-20)31-16-24(25,26)27/h2-9,19,22H,10-16H2,1H3/t19-,22+/m1/s1 |
| InChIKey | BWHASOFTXAAJEX-KNQAVFIVSA-N |
| XLogP | 4.46 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |