C15H25N3O4 — CID 163470900
N-methyl-N'-[[5-oxo-1-[(3R)-2-oxopentan-3-yl]pyrrolidin-3-yl]methyl]butanediamide (PubChem CID 163470900) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-methyl-N'-[[5-oxo-1-[(3R)-2-oxopentan-3-yl]pyrrolidin-3-yl]methyl]butanediamide.
| Compound Name | N-methyl-N'-[[5-oxo-1-[(3R)-2-oxopentan-3-yl]pyrrolidin-3-yl]methyl]butanediamide |
|---|---|
| PubChem CID | 163470900 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-methyl-N'-[[5-oxo-1-[(3R)-2-oxopentan-3-yl]pyrrolidin-3-yl]methyl]butanediamide |
| SMILES | CC[C@H](C(C)=O)N1CC(CNC(=O)CCC(=O)NC)CC1=O |
| InChI | InChI=1S/C15H25N3O4/c1-4-12(10(2)19)18-9-11(7-15(18)22)8-17-14(21)6-5-13(20)16-3/h11-12H,4-9H2,1-3H3,(H,16,20)(H,17,21)/t11?,12-/m1/s1 |
| InChIKey | UOYRGCPLNLNUBX-PIJUOVFKSA-N |
| XLogP | -0.16 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |