C12H13NO2 — CID 163471123
10-oxido-3,5a,9a,10-tetrahydro-2H-phenoxazin-10-ium (PubChem CID 163471123) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 10-oxido-3,5a,9a,10-tetrahydro-2H-phenoxazin-10-ium.
| Compound Name | 10-oxido-3,5a,9a,10-tetrahydro-2H-phenoxazin-10-ium |
|---|---|
| PubChem CID | 163471123 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 10-oxido-3,5a,9a,10-tetrahydro-2H-phenoxazin-10-ium |
| SMILES | [O-][NH+]1C2=CCCC=C2OC2C=CC=CC21 |
| InChI | InChI=1S/C12H13NO2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,5-9,11,13H,2,4H2 |
| InChIKey | BWPSRZKACOBGEA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 36.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |