About (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium
(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium (PubChem CID 163471516) has the molecular formula C7H8O4P+
and a molecular weight of 187.11 g/mol. Its IUPAC name is (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium.
Molecular Properties
| Compound Name | (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium |
| PubChem CID | 163471516 |
| Molecular Formula | C7H8O4P+ |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium |
| SMILES | O=P1([OH2+])OCc2ccccc2O1 |
| InChI | InChI=1S/C7H7O4P/c8-12(9)10-5-6-3-1-2-4-7(6)11-12/h1-4H,5H2,(H,8,9)/p+1 |
| InChIKey | BWXMZQVOURECFS-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 58.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium?
The IUPAC name of (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium (CID 163471516) is (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium.
What is the SMILES notation for (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium?
The canonical SMILES for (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium is O=P1([OH2+])OCc2ccccc2O1.
What is the InChIKey of (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium?
The InChIKey is BWXMZQVOURECFS-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H7O4P/c8-12(9)10-5-6-3-1-2-4-7(6)11-12/h1-4H,5H2,(H,8,9)/p+1.
What are the key properties of (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium?
(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium has a molecular weight of 187.11 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxidanium is sourced from PubChem (CID 163471516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).