About 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one
6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one (PubChem CID 163471632) has the molecular formula C14H15Cl2N3O2
and a molecular weight of 328.20 g/mol. Its IUPAC name is 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one.
Molecular Properties
| Compound Name | 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one |
| PubChem CID | 163471632 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one |
| SMILES | CC(C)C1=CC(Oc2c(Cl)cc(NN)cc2Cl)=NCC1=O |
| InChI | InChI=1S/C14H15Cl2N3O2/c1-7(2)9-5-13(18-6-12(9)20)21-14-10(15)3-8(19-17)4-11(14)16/h3-5,7,19H,6,17H2,1-2H3 |
| InChIKey | CAXCOVRKQMZIQR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one?
The IUPAC name of 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one (CID 163471632) is 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one.
What is the SMILES notation for 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one?
The canonical SMILES for 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one is CC(C)C1=CC(Oc2c(Cl)cc(NN)cc2Cl)=NCC1=O.
What is the InChIKey of 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one?
The InChIKey is CAXCOVRKQMZIQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N3O2/c1-7(2)9-5-13(18-6-12(9)20)21-14-10(15)3-8(19-17)4-11(14)16/h3-5,7,19H,6,17H2,1-2H3.
What are the key properties of 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one?
6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one has a molecular weight of 328.20 g/mol, XLogP of 3.22, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dichloro-4-hydrazinylphenoxy)-4-propan-2-yl-2H-pyridin-3-one is sourced from PubChem (CID 163471632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).