C48H60N3+3 — CID 163471923
2-(2,5-dimethylphenyl)-1,4,6-trimethylpyridin-1-ium;bis(2-(2,6-dimethylphenyl)-1,4,6-trimethylpyridin-1-ium) (PubChem CID 163471923) has the molecular formula C48H60N3+3 and a molecular weight of 679.03 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1,4,6-trimethylpyridin-1-ium;bis(2-(2,6-dimethylphenyl)-1,4,6-trimethylpyridin-1-ium).
| Compound Name | 2-(2,5-dimethylphenyl)-1,4,6-trimethylpyridin-1-ium;bis(2-(2,6-dimethylphenyl)-1,4,6-trimethylpyridin-1-ium) |
|---|---|
| PubChem CID | 163471923 |
| Molecular Formula | C48H60N3+3 |
| Molecular Weight | 679.03 g/mol |
| Exact Mass | 678.48 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,4,6-trimethylpyridin-1-ium;bis(2-(2,6-dimethylphenyl)-1,4,6-trimethylpyridin-1-ium) |
| SMILES | Cc1cc(C)[n+](C)c(-c2c(C)cccc2C)c1.Cc1cc(C)[n+](C)c(-c2c(C)cccc2C)c1.Cc1ccc(C)c(-c2cc(C)cc(C)[n+]2C)c1 |
| InChI | InChI=1S/3C16H20N/c1-11-6-7-13(3)15(9-11)16-10-12(2)8-14(4)17(16)5;2*1-11-9-14(4)17(5)15(10-11)16-12(2)7-6-8-13(16)3/h3*6-10H,1-5H3/q3*+1 |
| InChIKey | GVWIJXHKQKTNJJ-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.03 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|