C15H22O5 — CID 163472304
(3Z)-15-methyl-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),3,17-triene (PubChem CID 163472304) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3Z)-15-methyl-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),3,17-triene.
| Compound Name | (3Z)-15-methyl-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),3,17-triene |
|---|---|
| PubChem CID | 163472304 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (3Z)-15-methyl-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(19),3,17-triene |
| SMILES | CC12CC=CC=C1O/C=C\OCCOCCOCCO2 |
| InChI | InChI=1S/C15H22O5/c1-15-5-3-2-4-14(15)19-12-10-17-8-6-16-7-9-18-11-13-20-15/h2-4,10,12H,5-9,11,13H2,1H3/b12-10- |
| InChIKey | BXNLZZMIDGNRBS-BENRWUELSA-N |
| XLogP | 2.16 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |