C23H23IN4O — CID 163472772
4-[[2-[2-(1-benzyl-2-oxopyrrolidin-3-yl)ethyl]-1λ3-ioda-2,5-diazacyclopenta-3,5-dien-3-yl]methyl]benzonitrile (PubChem CID 163472772) has the molecular formula C23H23IN4O and a molecular weight of 498.37 g/mol. Its IUPAC name is 4-[[2-[2-(1-benzyl-2-oxopyrrolidin-3-yl)ethyl]-1λ3-ioda-2,5-diazacyclopenta-3,5-dien-3-yl]methyl]benzonitrile.
| Compound Name | 4-[[2-[2-(1-benzyl-2-oxopyrrolidin-3-yl)ethyl]-1λ3-ioda-2,5-diazacyclopenta-3,5-dien-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 163472772 |
| Molecular Formula | C23H23IN4O |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 4-[[2-[2-(1-benzyl-2-oxopyrrolidin-3-yl)ethyl]-1λ3-ioda-2,5-diazacyclopenta-3,5-dien-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CC2=CN=IN2CCC2CCN(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H23IN4O/c25-15-19-8-6-18(7-9-19)14-22-16-26-24-28(22)13-11-21-10-12-27(23(21)29)17-20-4-2-1-3-5-20/h1-9,16,21H,10-14,17H2 |
| InChIKey | BXXRWGYCBUXGEK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|