C18H18N6 — CID 163473479
1-[(2Z,4Z)-2-aminohepta-2,4-dien-6-ynylidene]-2-(4,6-dimethylquinazolin-2-yl)guanidine (PubChem CID 163473479) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-[(2Z,4Z)-2-aminohepta-2,4-dien-6-ynylidene]-2-(4,6-dimethylquinazolin-2-yl)guanidine.
| Compound Name | 1-[(2Z,4Z)-2-aminohepta-2,4-dien-6-ynylidene]-2-(4,6-dimethylquinazolin-2-yl)guanidine |
|---|---|
| PubChem CID | 163473479 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[(2Z,4Z)-2-aminohepta-2,4-dien-6-ynylidene]-2-(4,6-dimethylquinazolin-2-yl)guanidine |
| SMILES | C#C/C=C\C=C(/N)C=NC(N)=Nc1nc(C)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C18H18N6/c1-4-5-6-7-14(19)11-21-17(20)24-18-22-13(3)15-10-12(2)8-9-16(15)23-18/h1,5-11H,19H2,2-3H3,(H2,20,22,23,24)/b6-5-,14-7-,21-11? |
| InChIKey | BYMWOCOALXYEBT-ZVWCJXQRSA-N |
| XLogP | 2.30 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|