C16H33NO7Si — CID 163473866
[3-[butyl(methyl)amino]-2-hydroxy-3-oxopropyl] 5-trimethoxysilylpentanoate (PubChem CID 163473866) has the molecular formula C16H33NO7Si and a molecular weight of 379.53 g/mol. Its IUPAC name is [3-[butyl(methyl)amino]-2-hydroxy-3-oxopropyl] 5-trimethoxysilylpentanoate.
| Compound Name | [3-[butyl(methyl)amino]-2-hydroxy-3-oxopropyl] 5-trimethoxysilylpentanoate |
|---|---|
| PubChem CID | 163473866 |
| Molecular Formula | C16H33NO7Si |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [3-[butyl(methyl)amino]-2-hydroxy-3-oxopropyl] 5-trimethoxysilylpentanoate |
| SMILES | CCCCN(C)C(=O)C(O)COC(=O)CCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C16H33NO7Si/c1-6-7-11-17(2)16(20)14(18)13-24-15(19)10-8-9-12-25(21-3,22-4)23-5/h14,18H,6-13H2,1-5H3 |
| InChIKey | OVEHFYFOFYTQDA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|