C40H16Br7NO12-2 — CID 163473996
2,4,5,7-tetrabromo-9-(2-carboxyphenyl)-6-oxoxanthen-3-olate;2,4,5-tribromo-6-hydroxy-7-nitroxanthen-3-one;benzoate (PubChem CID 163473996) has the molecular formula C40H16Br7NO12-2 and a molecular weight of 1261.89 g/mol. Its IUPAC name is 2,4,5,7-tetrabromo-9-(2-carboxyphenyl)-6-oxoxanthen-3-olate;2,4,5-tribromo-6-hydroxy-7-nitroxanthen-3-one;benzoate.
| Compound Name | 2,4,5,7-tetrabromo-9-(2-carboxyphenyl)-6-oxoxanthen-3-olate;2,4,5-tribromo-6-hydroxy-7-nitroxanthen-3-one;benzoate |
|---|---|
| PubChem CID | 163473996 |
| Molecular Formula | C40H16Br7NO12-2 |
| Molecular Weight | 1261.89 g/mol |
| Exact Mass | 1254.50 |
| IUPAC Name | 2,4,5,7-tetrabromo-9-(2-carboxyphenyl)-6-oxoxanthen-3-olate;2,4,5-tribromo-6-hydroxy-7-nitroxanthen-3-one;benzoate |
| SMILES | O=C(O)c1ccccc1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(Br)c([O-])c(Br)cc12.O=C([O-])c1ccccc1.O=c1c(Br)cc2cc3cc([N+](=O)[O-])c(O)c(Br)c3oc-2c1Br |
| InChI | InChI=1S/C20H8Br4O5.C13H4Br3NO5.C7H6O2/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25;14-6-2-4-1-5-3-7(17(20)21)11(19)9(16)13(5)22-12(4)8(15)10(6)18;8-7(9)6-4-2-1-3-5-6/h1-6,25H,(H,27,28);1-3,19H;1-5H,(H,8,9)/p-2 |
| InChIKey | SMNJWAVRAYYSOL-UHFFFAOYSA-L |
| XLogP | 11.24 |
| TPSA | 224.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1261.89 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|