C12H20N4O2 — CID 163474003
5-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-amine (PubChem CID 163474003) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 5-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-amine.
| Compound Name | 5-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-amine |
|---|---|
| PubChem CID | 163474003 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 5-[3-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-amine |
| SMILES | CC(C)(C)OC1OC1N1CCn2nc(N)cc2C1 |
| InChI | InChI=1S/C12H20N4O2/c1-12(2,3)18-11-10(17-11)15-4-5-16-8(7-15)6-9(13)14-16/h6,10-11H,4-5,7H2,1-3H3,(H2,13,14) |
| InChIKey | BYWOLRMHCUDKDA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|