C19H32N4O2 — CID 163474124
5-amino-N-propan-2-yl-1H-indole-2-carboxamide;N,N-dimethyl-2-propan-2-yloxyethanamine (PubChem CID 163474124) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 5-amino-N-propan-2-yl-1H-indole-2-carboxamide;N,N-dimethyl-2-propan-2-yloxyethanamine.
| Compound Name | 5-amino-N-propan-2-yl-1H-indole-2-carboxamide;N,N-dimethyl-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 163474124 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 5-amino-N-propan-2-yl-1H-indole-2-carboxamide;N,N-dimethyl-2-propan-2-yloxyethanamine |
| SMILES | CC(C)NC(=O)c1cc2cc(N)ccc2[nH]1.CC(C)OCCN(C)C |
| InChI | InChI=1S/C12H15N3O.C7H17NO/c1-7(2)14-12(16)11-6-8-5-9(13)3-4-10(8)15-11;1-7(2)9-6-5-8(3)4/h3-7,15H,13H2,1-2H3,(H,14,16);7H,5-6H2,1-4H3 |
| InChIKey | BYZFBBDXRZZNKF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|