C21H26O3S — CID 163474423
(4S,5R)-5-cyclohexa-2,4-dien-1-yl-1,1-dioxospiro[4,5-dihydro-2H-1λ6-benzothiepine-3,1'-cyclohexane]-4-ol (PubChem CID 163474423) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is (4S,5R)-5-cyclohexa-2,4-dien-1-yl-1,1-dioxospiro[4,5-dihydro-2H-1λ6-benzothiepine-3,1'-cyclohexane]-4-ol.
| Compound Name | (4S,5R)-5-cyclohexa-2,4-dien-1-yl-1,1-dioxospiro[4,5-dihydro-2H-1λ6-benzothiepine-3,1'-cyclohexane]-4-ol |
|---|---|
| PubChem CID | 163474423 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (4S,5R)-5-cyclohexa-2,4-dien-1-yl-1,1-dioxospiro[4,5-dihydro-2H-1λ6-benzothiepine-3,1'-cyclohexane]-4-ol |
| SMILES | O=S1(=O)CC2(CCCCC2)[C@@H](O)[C@H](C2C=CC=CC2)c2ccccc21 |
| InChI | InChI=1S/C21H26O3S/c22-20-19(16-9-3-1-4-10-16)17-11-5-6-12-18(17)25(23,24)15-21(20)13-7-2-8-14-21/h1,3-6,9,11-12,16,19-20,22H,2,7-8,10,13-15H2/t16?,19-,20+/m1/s1 |
| InChIKey | BZGFZEHYTJWOKR-OHAXFNJZSA-N |
| XLogP | 4.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |