C18H18N4O3 — CID 163474508
10-methyl-8,14-dioxa-4,10,19,20-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2,4,6(23),15(22),16,18(21)-heptaen-9-one (PubChem CID 163474508) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 10-methyl-8,14-dioxa-4,10,19,20-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2,4,6(23),15(22),16,18(21)-heptaen-9-one.
| Compound Name | 10-methyl-8,14-dioxa-4,10,19,20-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2,4,6(23),15(22),16,18(21)-heptaen-9-one |
|---|---|
| PubChem CID | 163474508 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 10-methyl-8,14-dioxa-4,10,19,20-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2,4,6(23),15(22),16,18(21)-heptaen-9-one |
| SMILES | CN1CCCOc2ccc3[nH]nc(c3c2)-c2cncc(c2)COC1=O |
| InChI | InChI=1S/C18H18N4O3/c1-22-5-2-6-24-14-3-4-16-15(8-14)17(21-20-16)13-7-12(9-19-10-13)11-25-18(22)23/h3-4,7-10H,2,5-6,11H2,1H3,(H,20,21) |
| InChIKey | BZIMOUHECMAWOG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |