C39H37N — CID 163475592
11,11,12,12,13,13-hexamethyl-N,N-diphenylindeno[2,1-a]phenanthren-9-amine (PubChem CID 163475592) has the molecular formula C39H37N and a molecular weight of 519.73 g/mol. Its IUPAC name is 11,11,12,12,13,13-hexamethyl-N,N-diphenylindeno[2,1-a]phenanthren-9-amine.
| Compound Name | 11,11,12,12,13,13-hexamethyl-N,N-diphenylindeno[2,1-a]phenanthren-9-amine |
|---|---|
| PubChem CID | 163475592 |
| Molecular Formula | C39H37N |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 11,11,12,12,13,13-hexamethyl-N,N-diphenylindeno[2,1-a]phenanthren-9-amine |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2ccc3c(c21)C(C)(C)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C39H37N/c1-37(2)34-25-28(40(26-15-9-7-10-16-26)27-17-11-8-12-18-27)21-22-30(34)31-23-24-32-29-19-13-14-20-33(29)38(3,4)39(5,6)36(32)35(31)37/h7-25H,1-6H3 |
| InChIKey | FVLMYUQGOBBUHC-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |