C45H33N3O — CID 163476020
7-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-9-ethyl-9-methylxanthene-1-carbonitrile (PubChem CID 163476020) has the molecular formula C45H33N3O and a molecular weight of 631.78 g/mol. Its IUPAC name is 7-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-9-ethyl-9-methylxanthene-1-carbonitrile.
| Compound Name | 7-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-9-ethyl-9-methylxanthene-1-carbonitrile |
|---|---|
| PubChem CID | 163476020 |
| Molecular Formula | C45H33N3O |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | 7-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-9-ethyl-9-methylxanthene-1-carbonitrile |
| SMILES | CCC1(C)c2cc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5ccccc5)cc4)n3)ccc2Oc2cccc(C#N)c21 |
| InChI | InChI=1S/C45H33N3O/c1-3-45(2)38-27-36(25-26-41(38)49-42-16-10-15-37(29-46)43(42)45)40-28-39(34-21-17-32(18-22-34)30-11-6-4-7-12-30)47-44(48-40)35-23-19-33(20-24-35)31-13-8-5-9-14-31/h4-28H,3H2,1-2H3 |
| InChIKey | CALRZHDOHFPDQV-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |