C21H36O6 — CID 163477386
1-(3-butyl-6-hydroxy-4-pentylcyclohexen-1-yl)-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol (PubChem CID 163477386) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-(3-butyl-6-hydroxy-4-pentylcyclohexen-1-yl)-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol.
| Compound Name | 1-(3-butyl-6-hydroxy-4-pentylcyclohexen-1-yl)-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol |
|---|---|
| PubChem CID | 163477386 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-(3-butyl-6-hydroxy-4-pentylcyclohexen-1-yl)-3-(hydroxymethyl)-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol |
| SMILES | CCCCCC1CC(O)C(C23OC(CO)C(O)C(O)C2O3)=CC1CCCC |
| InChI | InChI=1S/C21H36O6/c1-3-5-7-9-14-11-16(23)15(10-13(14)8-6-4-2)21-20(27-21)19(25)18(24)17(12-22)26-21/h10,13-14,16-20,22-25H,3-9,11-12H2,1-2H3 |
| InChIKey | CBPUBBRLZOMTQL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|