C19H21FN6O2 — CID 163478335
4-[(3S,3aS)-3-(4,5-dihydrotriazol-1-ylmethyl)-7-fluoro-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-6-yl]piperidine-1-carbonitrile (PubChem CID 163478335) has the molecular formula C19H21FN6O2 and a molecular weight of 384.42 g/mol. Its IUPAC name is 4-[(3S,3aS)-3-(4,5-dihydrotriazol-1-ylmethyl)-7-fluoro-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-6-yl]piperidine-1-carbonitrile.
| Compound Name | 4-[(3S,3aS)-3-(4,5-dihydrotriazol-1-ylmethyl)-7-fluoro-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-6-yl]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 163478335 |
| Molecular Formula | C19H21FN6O2 |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-[(3S,3aS)-3-(4,5-dihydrotriazol-1-ylmethyl)-7-fluoro-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-6-yl]piperidine-1-carbonitrile |
| SMILES | N#CN1CCC(c2cc3c(cc2F)N2C(=O)O[C@@H](CN4CCN=N4)[C@@H]2C3)CC1 |
| InChI | InChI=1S/C19H21FN6O2/c20-15-9-16-13(7-14(15)12-1-4-24(11-21)5-2-12)8-17-18(28-19(27)26(16)17)10-25-6-3-22-23-25/h7,9,12,17-18H,1-6,8,10H2/t17-,18-/m0/s1 |
| InChIKey | CCJUBLZSRAFOHA-ROUUACIJSA-N |
| XLogP | 2.42 |
| TPSA | 84.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|