C20H8F2N2O — CID 163479333
3-dibenzofuran-4-yl-2,5-difluorobenzene-1,4-dicarbonitrile (PubChem CID 163479333) has the molecular formula C20H8F2N2O and a molecular weight of 330.29 g/mol. Its IUPAC name is 3-dibenzofuran-4-yl-2,5-difluorobenzene-1,4-dicarbonitrile.
| Compound Name | 3-dibenzofuran-4-yl-2,5-difluorobenzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 163479333 |
| Molecular Formula | C20H8F2N2O |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-dibenzofuran-4-yl-2,5-difluorobenzene-1,4-dicarbonitrile |
| SMILES | N#Cc1cc(F)c(C#N)c(-c2cccc3c2oc2ccccc23)c1F |
| InChI | InChI=1S/C20H8F2N2O/c21-16-8-11(9-23)19(22)18(15(16)10-24)14-6-3-5-13-12-4-1-2-7-17(12)25-20(13)14/h1-8H |
| InChIKey | CDEAQEALEQUJJI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 60.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |