About 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole
1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole (PubChem CID 163479555) has the molecular formula C22H16Br2N2
and a molecular weight of 468.19 g/mol. Its IUPAC name is 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole.
Molecular Properties
| Compound Name | 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole |
| PubChem CID | 163479555 |
| Molecular Formula | C22H16Br2N2 |
| Molecular Weight | 468.19 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole |
| SMILES | Brc1cc2nc(/C=C/c3ccccc3)n(Cc3ccccc3)c2cc1Br |
| InChI | InChI=1S/C22H16Br2N2/c23-18-13-20-21(14-19(18)24)26(15-17-9-5-2-6-10-17)22(25-20)12-11-16-7-3-1-4-8-16/h1-14H,15H2/b12-11+ |
| InChIKey | CDIQTNNWSDKVTE-VAWYXSNFSA-N |
| XLogP | 6.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.19 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole?
The IUPAC name of 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole (CID 163479555) is 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole.
What is the SMILES notation for 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole?
The canonical SMILES for 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole is Brc1cc2nc(/C=C/c3ccccc3)n(Cc3ccccc3)c2cc1Br.
What is the InChIKey of 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole?
The InChIKey is CDIQTNNWSDKVTE-VAWYXSNFSA-N. The full InChI is InChI=1S/C22H16Br2N2/c23-18-13-20-21(14-19(18)24)26(15-17-9-5-2-6-10-17)22(25-20)12-11-16-7-3-1-4-8-16/h1-14H,15H2/b12-11+.
What are the key properties of 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole?
1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole has a molecular weight of 468.19 g/mol, XLogP of 6.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5,6-dibromo-2-[(E)-2-phenylethenyl]benzimidazole is sourced from PubChem (CID 163479555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).