About (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol
(5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol (PubChem CID 163479799) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol.
Molecular Properties
| Compound Name | (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol |
| PubChem CID | 163479799 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol |
| SMILES | OC1CC2=CC[C@H](C1)C21OCCO1 |
| InChI | InChI=1S/C10H14O3/c11-9-5-7-1-2-8(6-9)10(7)12-3-4-13-10/h1,8-9,11H,2-6H2/t8-,9?/m1/s1 |
| InChIKey | CDOJHNPUKQCWFR-VEDVMXKPSA-N |
| XLogP | 0.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol?
The IUPAC name of (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol (CID 163479799) is (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol.
What is the SMILES notation for (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol?
The canonical SMILES for (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol is OC1CC2=CC[C@H](C1)C21OCCO1.
What is the InChIKey of (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol?
The InChIKey is CDOJHNPUKQCWFR-VEDVMXKPSA-N. The full InChI is InChI=1S/C10H14O3/c11-9-5-7-1-2-8(6-9)10(7)12-3-4-13-10/h1,8-9,11H,2-6H2/t8-,9?/m1/s1.
What are the key properties of (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol?
(5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol has a molecular weight of 182.22 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5'R)-spiro[1,3-dioxolane-2,8'-bicyclo[3.2.1]oct-1(7)-ene]-3'-ol is sourced from PubChem (CID 163479799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).