C25H47FN7O+ — CID 163480861
3,3-diamino-2-(4-butyl-7-fluoro-4-methyl-1-azoniacycloocta-1,8-dien-2-yl)-N-[4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide (PubChem CID 163480861) has the molecular formula C25H47FN7O+ and a molecular weight of 480.70 g/mol. Its IUPAC name is 3,3-diamino-2-(4-butyl-7-fluoro-4-methyl-1-azoniacycloocta-1,8-dien-2-yl)-N-[4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(4-butyl-7-fluoro-4-methyl-1-azoniacycloocta-1,8-dien-2-yl)-N-[4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 163480861 |
| Molecular Formula | C25H47FN7O+ |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | 3,3-diamino-2-(4-butyl-7-fluoro-4-methyl-1-azoniacycloocta-1,8-dien-2-yl)-N-[4-(4-methylpiperazin-1-yl)piperidin-3-yl]propanamide |
| SMILES | CCCCC1(C)CCC(F)C=[N+]=C(C(C(=O)NC2CNCCC2N2CCN(C)CC2)C(N)N)C1 |
| InChI | InChI=1S/C25H46FN7O/c1-4-5-8-25(2)9-6-18(26)16-30-19(15-25)22(23(27)28)24(34)31-20-17-29-10-7-21(20)33-13-11-32(3)12-14-33/h16,18,20-23,29H,4-15,17,27-28H2,1-3H3/p+1 |
| InChIKey | VNMFIHQSPALZPU-UHFFFAOYSA-O |
| XLogP | 0.24 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|