About 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene
3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene (PubChem CID 163481499) has the molecular formula C7H8Cl2S
and a molecular weight of 195.11 g/mol. Its IUPAC name is 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene |
| PubChem CID | 163481499 |
| Molecular Formula | C7H8Cl2S |
| Molecular Weight | 195.11 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene |
| SMILES | C=CC1=C(Cl)C(Cl)C(C)S1 |
| InChI | InChI=1S/C7H8Cl2S/c1-3-5-7(9)6(8)4(2)10-5/h3-4,6H,1H2,2H3 |
| InChIKey | CEXSIISSZXVRJX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.11 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene?
The IUPAC name of 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene (CID 163481499) is 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene.
What is the SMILES notation for 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene?
The canonical SMILES for 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene is C=CC1=C(Cl)C(Cl)C(C)S1.
What is the InChIKey of 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene?
The InChIKey is CEXSIISSZXVRJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl2S/c1-3-5-7(9)6(8)4(2)10-5/h3-4,6H,1H2,2H3.
What are the key properties of 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene?
3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene has a molecular weight of 195.11 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-5-ethenyl-2-methyl-2,3-dihydrothiophene is sourced from PubChem (CID 163481499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).