C23H30NO4+ — CID 163481763
[2-[3-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]-1-phenylmethoxyethylidene]oxidanium (PubChem CID 163481763) has the molecular formula C23H30NO4+ and a molecular weight of 384.50 g/mol. Its IUPAC name is [2-[3-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]-1-phenylmethoxyethylidene]oxidanium.
| Compound Name | [2-[3-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]-1-phenylmethoxyethylidene]oxidanium |
|---|---|
| PubChem CID | 163481763 |
| Molecular Formula | C23H30NO4+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [2-[3-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]-1-phenylmethoxyethylidene]oxidanium |
| SMILES | [H]/[O+]=C(/Cc1cccc(C[C@@H](C)NC(=O)OC(C)(C)C)c1)OCc1ccccc1 |
| InChI | InChI=1S/C23H29NO4/c1-17(24-22(26)28-23(2,3)4)13-19-11-8-12-20(14-19)15-21(25)27-16-18-9-6-5-7-10-18/h5-12,14,17H,13,15-16H2,1-4H3,(H,24,26)/p+1/t17-/m1/s1 |
| InChIKey | CFDXLIQDDFJDFB-QGZVFWFLSA-O |
| XLogP | 4.40 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|