C15H19ClN4O2S — CID 163483217
4-chloro-N-(3-methylsulfinylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 163483217) has the molecular formula C15H19ClN4O2S and a molecular weight of 354.86 g/mol. Its IUPAC name is 4-chloro-N-(3-methylsulfinylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | 4-chloro-N-(3-methylsulfinylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 163483217 |
| Molecular Formula | C15H19ClN4O2S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-chloro-N-(3-methylsulfinylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CS(=O)CCCNC(=O)C1CCc2[nH]c3ncnc(Cl)c3c2C1 |
| InChI | InChI=1S/C15H19ClN4O2S/c1-23(22)6-2-5-17-15(21)9-3-4-11-10(7-9)12-13(16)18-8-19-14(12)20-11/h8-9H,2-7H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | CGJDRJIBAWHVLG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|