C10H20FNO — CID 163483566
(5S,6R)-7-amino-5-(fluoromethyl)-4,6-dimethylheptan-3-one (PubChem CID 163483566) has the molecular formula C10H20FNO and a molecular weight of 189.27 g/mol. Its IUPAC name is (5S,6R)-7-amino-5-(fluoromethyl)-4,6-dimethylheptan-3-one.
| Compound Name | (5S,6R)-7-amino-5-(fluoromethyl)-4,6-dimethylheptan-3-one |
|---|---|
| PubChem CID | 163483566 |
| Molecular Formula | C10H20FNO |
| Molecular Weight | 189.27 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (5S,6R)-7-amino-5-(fluoromethyl)-4,6-dimethylheptan-3-one |
| SMILES | CCC(=O)C(C)[C@@H](CF)[C@@H](C)CN |
| InChI | InChI=1S/C10H20FNO/c1-4-10(13)8(3)9(5-11)7(2)6-12/h7-9H,4-6,12H2,1-3H3/t7-,8?,9-/m0/s1 |
| InChIKey | CGPSRPRDSZADBJ-SMOXQLQSSA-N |
| XLogP | 1.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |