C26H24FN3O7 — CID 163483841
N-[(10S)-10-ethyl-18-fluoro-10-hydroxy-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2,2-dihydroxyacetamide (PubChem CID 163483841) has the molecular formula C26H24FN3O7 and a molecular weight of 509.49 g/mol. Its IUPAC name is N-[(10S)-10-ethyl-18-fluoro-10-hydroxy-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2,2-dihydroxyacetamide.
| Compound Name | N-[(10S)-10-ethyl-18-fluoro-10-hydroxy-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2,2-dihydroxyacetamide |
|---|---|
| PubChem CID | 163483841 |
| Molecular Formula | C26H24FN3O7 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[(10S)-10-ethyl-18-fluoro-10-hydroxy-19-methyl-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2,2-dihydroxyacetamide |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2C(NC(=O)C(O)O)CC3 |
| InChI | InChI=1S/C26H24FN3O7/c1-3-26(36)14-6-18-21-12(8-30(18)23(32)13(14)9-37-25(26)35)20-16(29-22(31)24(33)34)5-4-11-10(2)15(27)7-17(28-21)19(11)20/h6-7,16,24,33-34,36H,3-5,8-9H2,1-2H3,(H,29,31)/t16?,26-/m0/s1 |
| InChIKey | CGVKBVKKHBEYEB-TZHIXCAUSA-N |
| XLogP | 0.94 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|