About (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol
(6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol (PubChem CID 163484580) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol.
Molecular Properties
| Compound Name | (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol |
| PubChem CID | 163484580 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol |
| SMILES | C=c1cc(O)cc(O)/c1=C/CCC |
| InChI | InChI=1S/C11H14O2/c1-3-4-5-10-8(2)6-9(12)7-11(10)13/h5-7,12-13H,2-4H2,1H3/b10-5+ |
| InChIKey | CHMIPDQNDZKDGF-BJMVGYQFSA-N |
| XLogP | 1.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol?
The IUPAC name of (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol (CID 163484580) is (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol.
What is the SMILES notation for (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol?
The canonical SMILES for (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol is C=c1cc(O)cc(O)/c1=C/CCC.
What is the InChIKey of (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol?
The InChIKey is CHMIPDQNDZKDGF-BJMVGYQFSA-N. The full InChI is InChI=1S/C11H14O2/c1-3-4-5-10-8(2)6-9(12)7-11(10)13/h5-7,12-13H,2-4H2,1H3/b10-5+.
What are the key properties of (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol?
(6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol has a molecular weight of 178.23 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-butylidene-5-methylidenecyclohexa-1,3-diene-1,3-diol is sourced from PubChem (CID 163484580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).