About (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene
(2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene (PubChem CID 163484709) has the molecular formula C10H12
and a molecular weight of 132.21 g/mol. Its IUPAC name is (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene.
Molecular Properties
| Compound Name | (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene |
| PubChem CID | 163484709 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene |
| SMILES | C1CC2CC3C4=C(C1C4)[C@@H]23 |
| InChI | InChI=1S/C10H12/c1-2-6-4-8-7-3-5(1)9(7)10(6)8/h5-7,9H,1-4H2/t5?,6?,7?,9-/m0/s1 |
| InChIKey | CHPGQFSTZPBDQU-IAANYJIPSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene?
The IUPAC name of (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene (CID 163484709) is (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene.
What is the SMILES notation for (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene?
The canonical SMILES for (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene is C1CC2CC3C4=C(C1C4)[C@@H]23.
What is the InChIKey of (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene?
The InChIKey is CHPGQFSTZPBDQU-IAANYJIPSA-N. The full InChI is InChI=1S/C10H12/c1-2-6-4-8-7-3-5(1)9(7)10(6)8/h5-7,9H,1-4H2/t5?,6?,7?,9-/m0/s1.
What are the key properties of (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene?
(2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene has a molecular weight of 132.21 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-tetracyclo[6.2.0.02,5.03,10]dec-1(10)-ene is sourced from PubChem (CID 163484709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).