C9H13NO3 — CID 163484851
(8aR)-4-isocyanato-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 163484851) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (8aR)-4-isocyanato-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (8aR)-4-isocyanato-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 163484851 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (8aR)-4-isocyanato-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | O=C=NC1CCO[C@@H]2CCCOC12 |
| InChI | InChI=1S/C9H13NO3/c11-6-10-7-3-5-12-8-2-1-4-13-9(7)8/h7-9H,1-5H2/t7?,8-,9?/m1/s1 |
| InChIKey | CHSMOKHDMODHAA-QJAFJHJLSA-N |
| XLogP | 0.66 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|