About 3,5-dimethyl-1,2-dihydroimidazol-2-ol
3,5-dimethyl-1,2-dihydroimidazol-2-ol (PubChem CID 163485394) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 3,5-dimethyl-1,2-dihydroimidazol-2-ol.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,2-dihydroimidazol-2-ol |
| PubChem CID | 163485394 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 3,5-dimethyl-1,2-dihydroimidazol-2-ol |
| SMILES | CC1=CN(C)C(O)N1 |
| InChI | InChI=1S/C5H10N2O/c1-4-3-7(2)5(8)6-4/h3,5-6,8H,1-2H3 |
| InChIKey | CICXDFCAPHWIPU-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethyl-1,2-dihydroimidazol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,2-dihydroimidazol-2-ol?
The IUPAC name of 3,5-dimethyl-1,2-dihydroimidazol-2-ol (CID 163485394) is 3,5-dimethyl-1,2-dihydroimidazol-2-ol.
What is the SMILES notation for 3,5-dimethyl-1,2-dihydroimidazol-2-ol?
The canonical SMILES for 3,5-dimethyl-1,2-dihydroimidazol-2-ol is CC1=CN(C)C(O)N1.
What is the InChIKey of 3,5-dimethyl-1,2-dihydroimidazol-2-ol?
The InChIKey is CICXDFCAPHWIPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-4-3-7(2)5(8)6-4/h3,5-6,8H,1-2H3.
What are the key properties of 3,5-dimethyl-1,2-dihydroimidazol-2-ol?
3,5-dimethyl-1,2-dihydroimidazol-2-ol has a molecular weight of 114.15 g/mol, XLogP of -0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,2-dihydroimidazol-2-ol is sourced from PubChem (CID 163485394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).