About (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid
(1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid (PubChem CID 163485586) has the molecular formula C9H17O2PS
and a molecular weight of 220.27 g/mol. Its IUPAC name is (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid.
Molecular Properties
| Compound Name | (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid |
| PubChem CID | 163485586 |
| Molecular Formula | C9H17O2PS |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid |
| SMILES | CCCC[P@@]1(=S)CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H17O2PS/c1-2-3-6-12(13)7-4-5-8(12)9(10)11/h8H,2-7H2,1H3,(H,10,11)/t8-,12-/m1/s1 |
| InChIKey | CIGCCJNIKKUVRG-PRHODGIISA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid?
The IUPAC name of (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid (CID 163485586) is (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid.
What is the SMILES notation for (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid?
The canonical SMILES for (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid is CCCC[P@@]1(=S)CCC[C@@H]1C(=O)O.
What is the InChIKey of (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid?
The InChIKey is CIGCCJNIKKUVRG-PRHODGIISA-N. The full InChI is InChI=1S/C9H17O2PS/c1-2-3-6-12(13)7-4-5-8(12)9(10)11/h8H,2-7H2,1H3,(H,10,11)/t8-,12-/m1/s1.
What are the key properties of (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid?
(1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid has a molecular weight of 220.27 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-1-butyl-1-sulfanylidene-1λ5-phospholane-2-carboxylic acid is sourced from PubChem (CID 163485586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).