About (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole
(5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole (PubChem CID 163485881) has the molecular formula C6H4ClF2IN2
and a molecular weight of 304.47 g/mol. Its IUPAC name is (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole.
Molecular Properties
| Compound Name | (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole |
| PubChem CID | 163485881 |
| Molecular Formula | C6H4ClF2IN2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole |
| SMILES | FC1(F)c2[nH]nc(Cl)c2C[C@H]1I |
| InChI | InChI=1S/C6H4ClF2IN2/c7-5-2-1-3(10)6(8,9)4(2)11-12-5/h3H,1H2,(H,11,12)/t3-/m1/s1 |
| InChIKey | CIMITCAKQPHENZ-GSVOUGTGSA-N |
| XLogP | 2.51 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole?
The IUPAC name of (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole (CID 163485881) is (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole.
What is the SMILES notation for (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole?
The canonical SMILES for (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole is FC1(F)c2[nH]nc(Cl)c2C[C@H]1I.
What is the InChIKey of (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole?
The InChIKey is CIMITCAKQPHENZ-GSVOUGTGSA-N. The full InChI is InChI=1S/C6H4ClF2IN2/c7-5-2-1-3(10)6(8,9)4(2)11-12-5/h3H,1H2,(H,11,12)/t3-/m1/s1.
What are the key properties of (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole?
(5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole has a molecular weight of 304.47 g/mol, XLogP of 2.51, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3-chloro-6,6-difluoro-5-iodo-4,5-dihydro-1H-cyclopenta[d]pyrazole is sourced from PubChem (CID 163485881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).