About (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene
(5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene (PubChem CID 163486366) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene.
Molecular Properties
| Compound Name | (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene |
| PubChem CID | 163486366 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene |
| SMILES | C=C/C=C\C[C@@H]1CC=CCC1C |
| InChI | InChI=1S/C12H18/c1-3-4-5-9-12-10-7-6-8-11(12)2/h3-7,11-12H,1,8-10H2,2H3/b5-4-/t11?,12-/m1/s1 |
| InChIKey | CIWUBQIFYBEUMX-MCQQVIDXSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene?
The IUPAC name of (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene (CID 163486366) is (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene.
What is the SMILES notation for (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene?
The canonical SMILES for (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene is C=C/C=C\C[C@@H]1CC=CCC1C.
What is the InChIKey of (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene?
The InChIKey is CIWUBQIFYBEUMX-MCQQVIDXSA-N. The full InChI is InChI=1S/C12H18/c1-3-4-5-9-12-10-7-6-8-11(12)2/h3-7,11-12H,1,8-10H2,2H3/b5-4-/t11?,12-/m1/s1.
What are the key properties of (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene?
(5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene has a molecular weight of 162.28 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-4-methyl-5-[(2Z)-penta-2,4-dienyl]cyclohexene is sourced from PubChem (CID 163486366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).